bis[(5-fluoropyridin-3-yl)methyl] hexanedioate structure
|
Common Name | bis[(5-fluoropyridin-3-yl)methyl] hexanedioate | ||
|---|---|---|---|---|
| CAS Number | 23586-91-6 | Molecular Weight | 364.34300 | |
| Density | 1.283g/cm3 | Boiling Point | 456.3ºC at 760 mmHg | |
| Molecular Formula | C18H18F2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.8ºC | |
| Name | bis[(5-fluoropyridin-3-yl)methyl] hexanedioate |
|---|
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 456.3ºC at 760 mmHg |
| Molecular Formula | C18H18F2N2O4 |
| Molecular Weight | 364.34300 |
| Flash Point | 229.8ºC |
| Exact Mass | 364.12300 |
| PSA | 78.38000 |
| LogP | 3.10180 |
| Vapour Pressure | 1.63E-08mmHg at 25°C |
| Index of Refraction | 1.53 |
| InChIKey | VCLPUOYTTCGZOH-UHFFFAOYSA-N |
| SMILES | O=C(CCCCC(=O)OCc1cncc(F)c1)OCc1cncc(F)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |