ethyl 2-(5-ethyl-2-nitroimidazol-1-yl)acetate
Modify Date: 2025-09-28 17:45:33
ethyl 2-(5-ethyl-2-nitroimidazol-1-yl)acetate structure
|
Common Name | ethyl 2-(5-ethyl-2-nitroimidazol-1-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 23571-54-2 | Molecular Weight | 227.21700 | |
| Density | 1.32g/cm3 | Boiling Point | 396.5ºC at 760mmHg | |
| Molecular Formula | C9H13N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | ethyl 2-(5-ethyl-2-nitroimidazol-1-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 396.5ºC at 760mmHg |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.21700 |
| Flash Point | 193.6ºC |
| Exact Mass | 227.09100 |
| PSA | 89.94000 |
| LogP | 1.44000 |
| Vapour Pressure | 1.7E-06mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | OVKDZRWGBXJOPR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cn1c(CC)cnc1[N+](=O)[O-] |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| L 7138 |
| 5-ethyl-2-nitro-1H-imidazole-1-acetic acid |
| 1H-Imidazole-1-acetic acid,5-ethyl-2-nitro-,ethyl ester |
| Imidazole-1-acetic acid,5-ethyl-2-nitro-,ethyl ester |