5-Isopropyl-1-methyl-2-nitro-1H-imidazole structure
|
Common Name | 5-Isopropyl-1-methyl-2-nitro-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 23571-34-8 | Molecular Weight | 169.18100 | |
| Density | 1.25g/cm3 | Boiling Point | 311.9ºC at 760 mmHg | |
| Molecular Formula | C7H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.5ºC | |
| Name | 1-methyl-2-nitro-5-propan-2-ylimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 311.9ºC at 760 mmHg |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18100 |
| Flash Point | 142.5ºC |
| Exact Mass | 169.08500 |
| PSA | 63.64000 |
| LogP | 1.97490 |
| Vapour Pressure | 0.000546mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | NOXMCEHYBLYCTK-UHFFFAOYSA-N |
| SMILES | CC(C)c1cnc([N+](=O)[O-])n1C |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Isopropyl-1-methyl-2-nitroimidazol |
| 1-Methyl-5-isopropyl-2-nitroimidazol |
| Imidazole,5-isopropyl-1-methyl-2-nitro |
| L 6347 |
| 5-Isopropyl-1-methyl-2-nitroimidazole |
| 1-Methyl-2-nitro-5-isopropylimidazol |
| DL-347 |
| 5-isopropyl-1-methyl-2-nitro-1H-imidazole |