N-(m-Fluorophenyl)isonicotinamidine structure
|
Common Name | N-(m-Fluorophenyl)isonicotinamidine | ||
|---|---|---|---|---|
| CAS Number | 23565-11-9 | Molecular Weight | 215.22600 | |
| Density | 1.21g/cm3 | Boiling Point | 382.8ºC at 760mmHg | |
| Molecular Formula | C12H10FN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.3ºC | |
| Name | N'-(3-fluorophenyl)pyridine-4-carboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 382.8ºC at 760mmHg |
| Molecular Formula | C12H10FN3 |
| Molecular Weight | 215.22600 |
| Flash Point | 185.3ºC |
| Exact Mass | 215.08600 |
| PSA | 51.27000 |
| LogP | 2.95800 |
| Vapour Pressure | 4.6E-06mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | PSASAOMEXWAJEI-UHFFFAOYSA-N |
| SMILES | NC(=Nc1cccc(F)c1)c1ccncc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(m-Fluorophenyl)isonicotinamidine |
| Fluoro-3'-phenyl-pyridino-4-amidin |
| 4-Pyridinecarboximidamide,N-(3-fluorophenyl) |
| Isonicotinamidine,N-(m-fluorophenyl)-(8CI) |
| ISONICOTINAMIDINE,N-(m-FLUOROPHENYL) |