N'-(3,4,5-trimethoxyphenyl)pyridine-3-carboximidamide
Modify Date: 2025-09-18 10:16:06
N'-(3,4,5-trimethoxyphenyl)pyridine-3-carboximidamide structure
|
Common Name | N'-(3,4,5-trimethoxyphenyl)pyridine-3-carboximidamide | ||
|---|---|---|---|---|
| CAS Number | 23564-94-5 | Molecular Weight | 287.31400 | |
| Density | 1.19g/cm3 | Boiling Point | 484.2ºC at 760mmHg | |
| Molecular Formula | C15H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.6ºC | |
| Name | N'-(3,4,5-trimethoxyphenyl)pyridine-3-carboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 484.2ºC at 760mmHg |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.31400 |
| Flash Point | 246.6ºC |
| Exact Mass | 287.12700 |
| PSA | 76.46000 |
| LogP | 2.71760 |
| Vapour Pressure | 1.58E-09mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | TXHHBTIHUYSISJ-UHFFFAOYSA-N |
| SMILES | COc1cc(N=C(N)c2cccnc2)cc(OC)c1OC |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Trimethoxy-3',4',5'-phenyl-pyridino-3-amidin |
| Nicotinamidine,N-(3,4,5-trimethoxyphenyl) |
| N-(3,4,5-trimethoxy-phenyl)-nicotinamidine |
| 3-Pyridinecarboximidamide,N-(3,4,5-trimethoxyphenyl) |