o-Chloro-N-(o-methoxyphenyl)benzamidine structure
|
Common Name | o-Chloro-N-(o-methoxyphenyl)benzamidine | ||
|---|---|---|---|---|
| CAS Number | 23564-73-0 | Molecular Weight | 260.71900 | |
| Density | 1.19g/cm3 | Boiling Point | 429.7ºC at 760mmHg | |
| Molecular Formula | C14H13ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.7ºC | |
| Name | 2-chloro-N'-(2-methoxyphenyl)benzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 429.7ºC at 760mmHg |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.71900 |
| Flash Point | 213.7ºC |
| Exact Mass | 260.07200 |
| PSA | 45.11000 |
| LogP | 3.95880 |
| Vapour Pressure | 1.37E-07mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | CHZBBHTWJDUPGU-UHFFFAOYSA-N |
| SMILES | COc1ccccc1N=C(N)c1ccccc1Cl |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Methoxy-2'-phenyl-chloro-1-benzamidin |