N-(2,5-Dimethoxyphenyl)isonicotinamidine
Modify Date: 2025-09-07 09:17:43
N-(2,5-Dimethoxyphenyl)isonicotinamidine structure
|
Common Name | N-(2,5-Dimethoxyphenyl)isonicotinamidine | ||
|---|---|---|---|---|
| CAS Number | 23564-31-0 | Molecular Weight | 257.28800 | |
| Density | 1.17g/cm3 | Boiling Point | 465.5ºC at 760 mmHg | |
| Molecular Formula | C14H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.3ºC | |
| Name | N'-(2,5-dimethoxyphenyl)pyridine-4-carboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 465.5ºC at 760 mmHg |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.28800 |
| Flash Point | 235.3ºC |
| Exact Mass | 257.11600 |
| PSA | 69.73000 |
| LogP | 2.83610 |
| Vapour Pressure | 7.65E-09mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | CPWOXKAVRFQOTE-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(N=C(N)c2ccncc2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ISONICOTINAMIDINE,N-(2,5-DIMETHOXYPHENYL) |
| 4-Pyridinecarboximidamide,N-(2,5-dimethoxyphenyl) |
| Dimethoxy-2',5'-phenyl-pyridino-4-amidin |
| N-(2,5-Dimethoxyphenyl)isonicotinamidine |