2',4'-Dinitro-2-fluoroacetanilide structure
|
Common Name | 2',4'-Dinitro-2-fluoroacetanilide | ||
|---|---|---|---|---|
| CAS Number | 23554-59-8 | Molecular Weight | 243.14900 | |
| Density | 1.603g/cm3 | Boiling Point | 469ºC at 760 mmHg | |
| Molecular Formula | C8H6FN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.4ºC | |
| Name | N-(2,4-dinitrophenyl)-2-fluoroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.603g/cm3 |
|---|---|
| Boiling Point | 469ºC at 760 mmHg |
| Molecular Formula | C8H6FN3O5 |
| Molecular Weight | 243.14900 |
| Flash Point | 237.4ºC |
| Exact Mass | 243.02900 |
| PSA | 124.23000 |
| LogP | 3.10690 |
| Vapour Pressure | 5.72E-09mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | OUHRISILAJAWAH-UHFFFAOYSA-N |
| SMILES | O=C(CF)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2',4'-Dinitro-2-fluoroacetanilide |
| ACETANILIDE,2',4'-DINITRO-2-FLUORO |