4-Thiazolidinone,3-[2-(3,4-dimethoxyphenyl)ethyl]-2-thioxo-
Modify Date: 2025-09-20 17:48:22
![4-Thiazolidinone,3-[2-(3,4-dimethoxyphenyl)ethyl]-2-thioxo- Structure](https://image.chemsrc.com/caspic/195/23522-20-5.png)
4-Thiazolidinone,3-[2-(3,4-dimethoxyphenyl)ethyl]-2-thioxo- structure
|
Common Name | 4-Thiazolidinone,3-[2-(3,4-dimethoxyphenyl)ethyl]-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 23522-20-5 | Molecular Weight | 297.39300 | |
| Density | 1.34g/cm3 | Boiling Point | 429.9ºC at 760mmHg | |
| Molecular Formula | C13H15NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8ºC | |
| Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 429.9ºC at 760mmHg |
| Molecular Formula | C13H15NO3S2 |
| Molecular Weight | 297.39300 |
| Flash Point | 213.8ºC |
| Exact Mass | 297.04900 |
| PSA | 96.16000 |
| LogP | 2.04450 |
| Vapour Pressure | 1.35E-07mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | LZSZXGHWVPFNKT-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCN2C(=O)CSC2=S)cc1OC |
| HS Code | 2934999090 |
|---|
|
~%
4-Thiazolidinon... CAS#:23522-20-5 |
| Literature: Buck; Leonard Journal of the American Chemical Society, 1931 , vol. 53, p. 2688,2690, 2691 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |