4,6-dichloro-N-(4-nitrophenyl)-1,3,5-triazin-2-amine
Modify Date: 2025-09-28 17:11:48
4,6-dichloro-N-(4-nitrophenyl)-1,3,5-triazin-2-amine structure
|
Common Name | 4,6-dichloro-N-(4-nitrophenyl)-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 2352-36-5 | Molecular Weight | 286.07400 | |
| Density | 1.674g/cm3 | Boiling Point | 531.7ºC at 760mmHg | |
| Molecular Formula | C9H5Cl2N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.4ºC | |
| Name | 4,6-dichloro-N-(4-nitrophenyl)-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.674g/cm3 |
|---|---|
| Boiling Point | 531.7ºC at 760mmHg |
| Molecular Formula | C9H5Cl2N5O2 |
| Molecular Weight | 286.07400 |
| Flash Point | 275.4ºC |
| Exact Mass | 284.98200 |
| PSA | 96.52000 |
| LogP | 3.42640 |
| Vapour Pressure | 2.18E-11mmHg at 25°C |
| Index of Refraction | 1.702 |
| InChIKey | YWQPGUGZNVYZPW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(Cl)nc(Cl)n2)cc1 |
|
~92%
4,6-dichloro-N-... CAS#:2352-36-5 |
| Literature: Shahin, Rand; Taha, Mutasem O. Bioorganic and Medicinal Chemistry, 2012 , vol. 20, # 1 p. 377 - 400 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,6-Dichlor-2-<4-nitro-anilino>-<1,3,5>triazin |