5-butyl-3-(4-chlorophenyl)-1,3,5-thiadiazinane-2-thione structure
|
Common Name | 5-butyl-3-(4-chlorophenyl)-1,3,5-thiadiazinane-2-thione | ||
|---|---|---|---|---|
| CAS Number | 23515-26-6 | Molecular Weight | 300.87000 | |
| Density | 1.31g/cm3 | Boiling Point | 409.9ºC at 760 mmHg | |
| Molecular Formula | C13H17ClN2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7ºC | |
| Name | 5-butyl-3-(4-chlorophenyl)-1,3,5-thiadiazinane-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 409.9ºC at 760 mmHg |
| Molecular Formula | C13H17ClN2S2 |
| Molecular Weight | 300.87000 |
| Flash Point | 201.7ºC |
| Exact Mass | 300.05200 |
| PSA | 63.87000 |
| LogP | 4.19810 |
| Vapour Pressure | 6.26E-07mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | BLJBPSAIWCSXAO-UHFFFAOYSA-N |
| SMILES | CCCCN1CSC(=S)N(c2ccc(Cl)cc2)C1 |
|
~%
Detail
|
| Literature: Shah,I.D.; Trivedi,J.P. Journal of the Indian Chemical Society, 1964 , vol. 41, p. 225 - 227 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 2-Thioxo-5-butyl-3-<4-chlor-phenyl>-tetrahydro-1,3,5-thiadiazin |