A-1210477-piperazinyl structure
|
Common Name | A-1210477-piperazinyl | ||
|---|---|---|---|---|
| CAS Number | 2351218-72-7 | Molecular Weight | 849.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C46H56N8O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of A-1210477-piperazinylA-1210477-piperazinyl is a compound binds to protein myeloid cell leukemia 1 (MCL1) used for PROTAC technology[1]. |
| Name | A-1210477-piperazinyl |
|---|
| Description | A-1210477-piperazinyl is a compound binds to protein myeloid cell leukemia 1 (MCL1) used for PROTAC technology[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C46H56N8O6S |
|---|---|
| Molecular Weight | 849.05 |
| InChIKey | VWUONMOPYOMHCJ-UHFFFAOYSA-N |
| SMILES | Cc1nn(C)c(COc2ccc(N3CCN(S(=O)(=O)N(C)C)CC3)cc2)c1-c1cccc2c(CCCOc3cccc4ccccc34)c(C(=O)O)n(CCN3CCNCC3)c12 |
| Storage condition | 2-8°C |