1,3-Pentanedione,5-anilino-1,5-diphenyl- (8CI)
Modify Date: 2025-10-01 10:28:25
1,3-Pentanedione,5-anilino-1,5-diphenyl- (8CI) structure
|
Common Name | 1,3-Pentanedione,5-anilino-1,5-diphenyl- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 23504-31-6 | Molecular Weight | 343.41800 | |
| Density | 1.172g/cm3 | Boiling Point | 524ºC at 760mmHg | |
| Molecular Formula | C23H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.8ºC | |
| Name | 5-anilino-1,5-diphenylpentane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 524ºC at 760mmHg |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.41800 |
| Flash Point | 170.8ºC |
| Exact Mass | 343.15700 |
| PSA | 46.17000 |
| LogP | 5.14500 |
| Vapour Pressure | 4.48E-11mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | AXZQDTZWPCEZSU-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)c1ccccc1)CC(Nc1ccccc1)c1ccccc1 |
|
~%
1,3-Pentanedion... CAS#:23504-31-6 |
| Literature: Sugiyama,N. et al. Bulletin of the Chemical Society of Japan, 1969 , vol. 42, p. 1357 - 1359 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Pyrrole,2,4-dinitro-1-pentyl |
| 1-Amyl-2,4-dinitropyrrol |
| 2,4-Dinitro-1-pentyl-1H-pyrrole |
| 1H-Pyrrole,2,4-dinitro-1-pentyl |