5,6,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one
Modify Date: 2025-08-23 14:21:39
5,6,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one structure
|
Common Name | 5,6,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one | ||
|---|---|---|---|---|
| CAS Number | 23494-48-6 | Molecular Weight | 316.26200 | |
| Density | 1.605g/cm3 | Boiling Point | 655ºC at 760 mmHg | |
| Molecular Formula | C16H12O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.3ºC | |
| Name | 5,6,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.605g/cm3 |
|---|---|
| Boiling Point | 655ºC at 760 mmHg |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.26200 |
| Flash Point | 249.3ºC |
| Exact Mass | 316.05800 |
| PSA | 120.36000 |
| LogP | 2.29100 |
| Vapour Pressure | 9.27E-18mmHg at 25°C |
| Index of Refraction | 1.727 |
| InChIKey | OZVBXGBZPZBKJO-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2cc(=O)c3c(O)c(O)c(O)cc3o2)ccc1O |
| HS Code | 2914509090 |
|---|
|
~%
5,6,7-Trihydrox... CAS#:23494-48-6
Detail
|
| Literature: Horie; Tominaga; Kawamura; Yamada Journal of Organic Chemistry, 1992 , vol. 57, # 12 p. 3343 - 3347 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| O6-Desmethyljaceosidin |
| Flavone,4',5,6,7-tetrahydroxy-3'-methoxy |
| Nodifloretin |
| Batatifolin |
| 4',5,6,7-Tetrahydroxy-3'-methoxyflavone |