Acetamide,N-(1,4-dihydro-1,4-dioxo-2-naphthalenyl)- structure
|
Common Name | Acetamide,N-(1,4-dihydro-1,4-dioxo-2-naphthalenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2348-74-5 | Molecular Weight | 215.20500 | |
| Density | 1.33g/cm3 | Boiling Point | 452ºC at 760 mmHg | |
| Molecular Formula | C12H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.2ºC | |
| Name | 2-Acetylamino-1,4-naphthoquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 452ºC at 760 mmHg |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.20500 |
| Flash Point | 201.2ºC |
| Exact Mass | 215.05800 |
| PSA | 63.24000 |
| LogP | 1.47650 |
| Vapour Pressure | 2.32E-08mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | CHRDDMHFEJSYTL-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=O)c2ccccc2C1=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-acetamido-1,4-naphthoquinone |
| 2-N-acetylamino-1,4-naphthoquinone |