3-[5-(4-Fluorophenyl)-1,3-oxazol-2-yl]propanoic acid structure
|
Common Name | 3-[5-(4-Fluorophenyl)-1,3-oxazol-2-yl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 23464-94-0 | Molecular Weight | 235.21100 | |
| Density | 1.314g/cm3 | Boiling Point | 409.4ºC at 760mmHg | |
| Molecular Formula | C12H10FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.4ºC | |
| Name | 3-[5-(4-Fluorophenyl)-1,3-oxazol-2-yl]propanoic acid |
|---|
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 409.4ºC at 760mmHg |
| Molecular Formula | C12H10FNO3 |
| Molecular Weight | 235.21100 |
| Flash Point | 201.4ºC |
| Exact Mass | 235.06400 |
| PSA | 63.33000 |
| LogP | 2.49790 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.55 |
| InChIKey | XCFZOPRHLRLVDB-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ncc(-c2ccc(F)cc2)o1 |
| HS Code | 2934999090 |
|---|
|
~%
3-[5-(4-Fluorop... CAS#:23464-94-0 |
| Literature: Short,F.W.; Long,L.M. Journal of Heterocyclic Chemistry, 1969 , vol. 6, p. 707 - 712 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |