Benzoicacid, 2-(2,4-dimethylbenzoyl)-3-methyl-
Modify Date: 2025-09-23 12:45:02
Benzoicacid, 2-(2,4-dimethylbenzoyl)-3-methyl- structure
|
Common Name | Benzoicacid, 2-(2,4-dimethylbenzoyl)-3-methyl- | ||
|---|---|---|---|---|
| CAS Number | 2346-66-9 | Molecular Weight | 268.30700 | |
| Density | 1.172g/cm3 | Boiling Point | 432.1ºC at 760mmHg | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.3ºC | |
| Name | 2-(2,4-dimethylbenzoyl)-3-methylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 432.1ºC at 760mmHg |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.30700 |
| Flash Point | 229.3ºC |
| Exact Mass | 268.11000 |
| PSA | 54.37000 |
| LogP | 3.54100 |
| Vapour Pressure | 3.12E-08mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | PJOFOPQGLKIHJA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2c(C)cccc2C(=O)O)c(C)c1 |
| HS Code | 2918300090 |
|---|
|
~%
Benzoicacid, 2-... CAS#:2346-66-9 |
| Literature: Newman; Muth Journal of the American Chemical Society, 1950 , vol. 72, p. 5191 Journal of the American Chemical Society, 1951 , vol. 73, p. 4629 |
|
~%
Benzoicacid, 2-... CAS#:2346-66-9 |
| Literature: Newman; Muth Journal of the American Chemical Society, 1950 , vol. 72, p. 5191 Journal of the American Chemical Society, 1951 , vol. 73, p. 4629 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-(2,4-dimethyl-benzoyl)-3-methyl-benzoic acid |
| 3-Methyl-2-(2,4-dimethyl-benzoyl)-benzoesaeure |
| Benzoicacid,2-(2,4-dimethylbenzoyl)-3-methyl |
| 2-(2,4-Dimethyl-benzoyl)-3-methyl-benzoesaeure |
| 2-[(2,4-dimethylphenyl)carbonyl]-3-methylbenzoic acid |