Glycine,N-(4-chloro-m-tolyl)-, ethyl ester (7CI,8CI)
Modify Date: 2025-10-20 17:17:08
Glycine,N-(4-chloro-m-tolyl)-, ethyl ester (7CI,8CI) structure
|
Common Name | Glycine,N-(4-chloro-m-tolyl)-, ethyl ester (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 2345-00-8 | Molecular Weight | 227.68700 | |
| Density | 1.197g/cm3 | Boiling Point | 337.7ºC at 760mmHg | |
| Molecular Formula | C11H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158ºC | |
| Name | ethyl 2-(4-chloro-3-methylanilino)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 337.7ºC at 760mmHg |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.68700 |
| Flash Point | 158ºC |
| Exact Mass | 227.07100 |
| PSA | 38.33000 |
| LogP | 2.69640 |
| Vapour Pressure | 0.000103mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | GACVYRYATGXSJC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNc1ccc(Cl)c(C)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| N-(4-Chlor-3-methyl-phenyl)-glycin-ethylester |
| ETHYL 2-[(4-CHLORO-3-METHYL-PHENYL)AMINO]ACETATE |
| Glycine,N-(4-chloro-m-tolyl)-,ethyl ester (7CI,8CI) |