2-amino-3,5-dinitrophenol structure
|
Common Name | 2-amino-3,5-dinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 23408-16-4 | Molecular Weight | 199.12100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-3,5-dinitrophenol |
|---|
| Molecular Formula | C6H5N3O5 |
|---|---|
| Molecular Weight | 199.12100 |
| Exact Mass | 199.02300 |
| PSA | 137.89000 |
| LogP | 2.41840 |
| InChIKey | QDKMCPXBRNXVCF-UHFFFAOYSA-N |
| SMILES | Nc1c(O)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |