2-Propanol,2-(2-phenyldiazenyl)-, 2-acetate
Modify Date: 2025-09-25 20:39:49
2-Propanol,2-(2-phenyldiazenyl)-, 2-acetate structure
|
Common Name | 2-Propanol,2-(2-phenyldiazenyl)-, 2-acetate | ||
|---|---|---|---|---|
| CAS Number | 23386-03-0 | Molecular Weight | 206.24100 | |
| Density | 1.04g/cm3 | Boiling Point | 256.9ºC at 760mmHg | |
| Molecular Formula | C11H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94.8ºC | |
| Name | 2-phenyldiazenylpropan-2-yl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 256.9ºC at 760mmHg |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24100 |
| Flash Point | 94.8ºC |
| Exact Mass | 206.10600 |
| PSA | 51.02000 |
| LogP | 3.06950 |
| Vapour Pressure | 0.015mmHg at 25°C |
| Index of Refraction | 1.51 |
| InChIKey | DRYIBTRMKBMBOX-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C)(C)N=Nc1ccccc1 |
| HS Code | 2927000090 |
|---|
|
~%
2-Propanol,2-(2... CAS#:23386-03-0 |
| Literature: Chang, Yau-Min; Profetto, Ralph; Warkentin, John Journal of the American Chemical Society, 1981 , vol. 103, # 24 p. 7189 - 7195 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Acetoxy-2-phenylazo-propan |
| 2-Benzolazo-2-acetoxy-propan |