4,5,6,7-tetrabromo-2-(trifluoromethyl)-1H-benzimidazole structure
|
Common Name | 4,5,6,7-tetrabromo-2-(trifluoromethyl)-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 2338-30-9 | Molecular Weight | 501.71800 | |
| Density | 2.594g/cm3 | Boiling Point | 471.2ºC at 760mmHg | |
| Molecular Formula | C8HBr4F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.8ºC | |
| Name | 4,5,6,7-tetrabromo-2-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.594g/cm3 |
|---|---|
| Boiling Point | 471.2ºC at 760mmHg |
| Molecular Formula | C8HBr4F3N2 |
| Molecular Weight | 501.71800 |
| Flash Point | 238.8ºC |
| Exact Mass | 497.68300 |
| PSA | 28.68000 |
| LogP | 5.63170 |
| Vapour Pressure | 1.34E-08mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | AGSFSCDYZMGUGS-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1nc2c(Br)c(Br)c(Br)c(Br)c2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5,6,7-Tetrabrom-2-trifluormethylbenzimidazol |
| 4,5,6,7-tetrabromo-2-trifluoromethyl-1H-benzoimidazole |
| 4,5,6,7-Tetrabromo-2-trifluoromethylbenzimidazole |