Trichloroacetic acid 2-chloro-4-(fluorosulfonyl)phenyl ester
Modify Date: 2025-09-22 17:35:13
Trichloroacetic acid 2-chloro-4-(fluorosulfonyl)phenyl ester structure
|
Common Name | Trichloroacetic acid 2-chloro-4-(fluorosulfonyl)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 23379-03-5 | Molecular Weight | 355.98200 | |
| Density | 1.745g/cm3 | Boiling Point | 363.6ºC at 760mmHg | |
| Molecular Formula | C8H3Cl4FO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.7ºC | |
| Name | (2-chloro-4-fluorosulfonylphenyl) 2,2,2-trichloroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.745g/cm3 |
|---|---|
| Boiling Point | 363.6ºC at 760mmHg |
| Molecular Formula | C8H3Cl4FO4S |
| Molecular Weight | 355.98200 |
| Flash Point | 173.7ºC |
| Exact Mass | 353.84900 |
| PSA | 68.82000 |
| LogP | 4.35460 |
| Vapour Pressure | 1.79E-05mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | OCTQHHDGKHCYKV-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(S(=O)(=O)F)cc1Cl)C(Cl)(Cl)Cl |
| HS Code | 2915400090 |
|---|
| HS Code | 2915400090 |
|---|---|
| Summary | 2915400090 mono-, di- or trichloroacetic acids, their salts and esters |
| Benzenesulfonyl fluoride,3-chloro-4-hydroxy-,trichloroacetate |
| 3-Chloro-4-hydroxybenzenesulfonyl fluoride trichloroacetate |
| 3-Chloro-4-trichloroacetyloxybenzenesulfonyl fluoride |