5-(2-METHOXYPHENYL)-4-(4-METHYLPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL
Modify Date: 2025-09-18 14:04:15
5-(2-METHOXYPHENYL)-4-(4-METHYLPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 5-(2-METHOXYPHENYL)-4-(4-METHYLPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 23292-16-2 | Molecular Weight | 297.37500 | |
| Density | 1.24g/cm3 | Boiling Point | 437.8ºC at 760mmHg | |
| Molecular Formula | C16H15N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.6ºC | |
| Name | 3-(2-methoxyphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 437.8ºC at 760mmHg |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.37500 |
| Flash Point | 218.6ºC |
| Exact Mass | 297.09400 |
| PSA | 78.74000 |
| LogP | 3.54000 |
| Vapour Pressure | 7.25E-08mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | MYMIOSWHDQLVHY-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-c1n[nH]c(=S)n1-c1ccc(C)cc1 |
| HS Code | 2933990090 |
|---|
|
~%
5-(2-METHOXYPHE... CAS#:23292-16-2 |
| Literature: Zelle, Robert; Galullo, Vincent P.; Baker, Christopher Todd; Will, Paul; Frazee, William Jack; Mazdiyasni, Hormoz; Guo, Jinsong Patent: US2007/281937 A1, 2007 ; Location in patent: Page/Page column 42 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(2-methoxyphenyl)-4-p-tolyl-4H-1,2,4-triazole-3-thiol |
| 5-(2-methoxy-phenyl)-4-p-tolyl-2,4-dihydro-[1,2,4]triazole-3-thione |
| 3-(2-methoxyphenyl)-4-(4-methylphenyl)-5-mercapto-1,2,4-triazole |
| 3-(o-Methoxy-phenyl)-4-(p-tolyl)-5-mercapto-4H-1,2,4-triazol |
| 3-(2-methoxy-phenyl)-4-(4-methyl-phenyl)-5-mercapto-triazole |
| 5-(2-methoxyphenyl)-4-(4-methylphenyl)-1,2,4-triazole-3-thiol |
| 5-(2-methoxyphenyl)-4-(4-methylphenyl)-4H-1,2,4-triazole-3-thiol |