1-Hydroxy-3,4,5-trimethoxyxanthone
Modify Date: 2025-08-22 09:20:23
1-Hydroxy-3,4,5-trimethoxyxanthone structure
|
Common Name | 1-Hydroxy-3,4,5-trimethoxyxanthone | ||
|---|---|---|---|---|
| CAS Number | 23251-63-0 | Molecular Weight | 302.27900 | |
| Density | 1.349 | Boiling Point | 513.5ºC at 760 mmHg | |
| Molecular Formula | C16H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Hydroxy-3,4,5-trimethoxy-9H-xanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.349 |
|---|---|
| Boiling Point | 513.5ºC at 760 mmHg |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.27900 |
| Exact Mass | 302.07900 |
| PSA | 78.13000 |
| LogP | 2.67760 |
| InChIKey | VXTZMXABRBBPJM-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(=O)c3cccc(OC)c3oc2c1OC |
| HS Code | 2932999099 |
|---|
|
~%
1-Hydroxy-3,4,5... CAS#:23251-63-0 |
| Literature: Neshta, N. M.; Glyzin, V. I.; Patudin, A. V. Chemistry of Natural Compounds, 1984 , vol. 20, # 1 p. 108 Khimiya Prirodnykh Soedinenii, 1984 , vol. 20, # 1 p. 110 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Bicyclo[2.2.2]octan-1-ol,3,3-dimethyl |
| 1-Hydroxy-3,3-dimethyl-bicyclo[2.2.2]octan |
| 1-hydroxy-3,4,5-trimethoxy-xanthen-9-one |
| Tovopyrifolin-B-5-O-methylether |
| 1-hydroxy-3,4,5-trimethoxyxanthone |