5-Ethyl-5-isopropyl-1-methylbarbituric acid structure
|
Common Name | 5-Ethyl-5-isopropyl-1-methylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 23245-81-0 | Molecular Weight | 212.24600 | |
| Density | 1.11g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-ethyl-1-methyl-5-propan-2-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.24600 |
| Exact Mass | 212.11600 |
| PSA | 69.97000 |
| LogP | 0.96080 |
| Index of Refraction | 1.472 |
| InChIKey | RRHUCBHZOOEMKK-UHFFFAOYSA-N |
| SMILES | CCC1(C(C)C)C(=O)NC(=O)N(C)C1=O |
| HS Code | 2933540000 |
|---|
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 5-Aethyl-5-isopropyl-1-methyl-barbitursaeure |
| Barbituric acid,5-ethyl-5-isopropyl-1-methyl |
| 5-ethyl-5-isopropyl-1-methyl-barbituric acid |
| 5-ethyl-5-isopropyl-1-methyl-pyrimidine-2,4,6-trione |