1-(3,5-dinitrophenyl)-3,5-dinitrobenzene structure
|
Common Name | 1-(3,5-dinitrophenyl)-3,5-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 23241-90-9 | Molecular Weight | 334.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H6N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3,5-dinitrophenyl)-3,5-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H6N4O8 |
|---|---|
| Molecular Weight | 334.19800 |
| Exact Mass | 334.01900 |
| PSA | 183.28000 |
| LogP | 5.07920 |
| InChIKey | SXKSGIFOQJTVSN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(-c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc([N+](=O)[O-])c1 |
|
~%
1-(3,5-dinitrop... CAS#:23241-90-9 |
| Literature: Case Journal of the American Chemical Society, 1942 , vol. 64, p. 1848,1850, 1851 |
|
~%
1-(3,5-dinitrop... CAS#:23241-90-9 |
| Literature: Zhou, Lihong; Lu, Wenjun Organometallics, 2012 , vol. 31, # 6 p. 2124 - 2127 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3.3'.5.5'-Tetranitro-biphenyl |
| 3,5,3',5'-Tetranitro-biphenyl |
| 1,1'-Biphenyl,3,3',5,5'-tetranitro |