Deterenol hydrochloride
Modify Date: 2025-09-17 20:32:45
Deterenol hydrochloride structure
|
Common Name | Deterenol hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 23239-36-3 | Molecular Weight | 231.71900 | |
| Density | N/A | Boiling Point | 355.9ºC at 760mmHg | |
| Molecular Formula | C11H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143ºC | |
Use of Deterenol hydrochlorideDeterenol hydrochloride is an Adrenergic agent. |
| Name | Deterenol Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 355.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H18ClNO2 |
| Molecular Weight | 231.71900 |
| Flash Point | 143ºC |
| Exact Mass | 231.10300 |
| PSA | 52.49000 |
| LogP | 2.61650 |
| Vapour Pressure | 1.11E-05mmHg at 25°C |
| InChIKey | KTOGVIILDSYTNS-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(O)c1ccc(O)cc1.Cl |
| HS Code | 2922509090 |
|---|
|
~91%
Deterenol hydro... CAS#:23239-36-3 |
| Literature: Chen, Jian Patent: US2005/250944 A1, 2005 ; Location in patent: Page/Page column 21 ; US 20050250944 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenol,hydrochloride |