5-ethyl-5-phenyl-1,3-bis(piperidin-1-ylmethyl)-1,3-diazinane-2,4,6-trione
Modify Date: 2025-09-23 23:40:08
5-ethyl-5-phenyl-1,3-bis(piperidin-1-ylmethyl)-1,3-diazinane-2,4,6-trione structure
|
Common Name | 5-ethyl-5-phenyl-1,3-bis(piperidin-1-ylmethyl)-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 23192-91-8 | Molecular Weight | 426.55200 | |
| Density | 1.183g/cm3 | Boiling Point | 539.5ºC at 760 mmHg | |
| Molecular Formula | C24H34N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8ºC | |
| Name | 5-ethyl-5-phenyl-1,3-bis(piperidin-1-ylmethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 539.5ºC at 760 mmHg |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.55200 |
| Flash Point | 213.8ºC |
| Exact Mass | 426.26300 |
| PSA | 64.17000 |
| LogP | 2.76360 |
| Vapour Pressure | 1.05E-11mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | JDPUAECPKWLADB-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2)C(=O)N(CN2CCCCC2)C(=O)N(CN2CCCCC2)C1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Zimet 176/68 |
| 5-ethyl-5-phenyl-1,3-bis-piperidin-1-ylmethyl-pyrimidine-2,4,6-trione |
| Imet 176-68 |
| 1,3-Bpp |