2-[3-(N-Ethylacetylamino)-2,4,6-triiodophenoxy]-2-(p-tolyl)acetic acid structure
|
Common Name | 2-[3-(N-Ethylacetylamino)-2,4,6-triiodophenoxy]-2-(p-tolyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 23189-43-7 | Molecular Weight | 705.06400 | |
| Density | 2.094g/cm3 | Boiling Point | 693.9ºC at 760 mmHg | |
| Molecular Formula | C19H18I3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 373.4ºC | |
| Name | 2-[3-[acetyl(ethyl)amino]-2,4,6-triiodophenoxy]-2-(4-methylphenyl)acetic acid |
|---|
| Density | 2.094g/cm3 |
|---|---|
| Boiling Point | 693.9ºC at 760 mmHg |
| Molecular Formula | C19H18I3NO4 |
| Molecular Weight | 705.06400 |
| Flash Point | 373.4ºC |
| Exact Mass | 704.83700 |
| PSA | 66.84000 |
| LogP | 5.38630 |
| Vapour Pressure | 3.27E-20mmHg at 25°C |
| Index of Refraction | 1.704 |
| InChIKey | YMYYUWULQPFDKA-UHFFFAOYSA-N |
| SMILES | CCN(C(C)=O)c1c(I)cc(I)c(OC(C(=O)O)c2ccc(C)cc2)c1I |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |