5-Nitro-1-benzofuran-2-carbaldehyde
Modify Date: 2025-08-24 23:02:36
5-Nitro-1-benzofuran-2-carbaldehyde structure
|
Common Name | 5-Nitro-1-benzofuran-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 23145-18-8 | Molecular Weight | 191.14000 | |
| Density | 1.471g/cm3 | Boiling Point | 352.8ºC at 760 mmHg | |
| Molecular Formula | C9H5NO4 | Melting Point | 161-163ºC | |
| MSDS | N/A | Flash Point | 167.1ºC | |
| Name | 5-Nitro-1-benzofuran-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.471g/cm3 |
|---|---|
| Boiling Point | 352.8ºC at 760 mmHg |
| Melting Point | 161-163ºC |
| Molecular Formula | C9H5NO4 |
| Molecular Weight | 191.14000 |
| Flash Point | 167.1ºC |
| Exact Mass | 191.02200 |
| PSA | 76.03000 |
| LogP | 2.67670 |
| Vapour Pressure | 3.76E-05mmHg at 25°C |
| Index of Refraction | 1.691 |
| InChIKey | NJHFCKIZFVVFTC-UHFFFAOYSA-N |
| SMILES | O=Cc1cc2cc([N+](=O)[O-])ccc2o1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-nitrobenzo[b]furan-2-carbaldehyde |
| 5-nitro-benzofuran-2-carbaldehyde |
| nitrobenzofurancarbaldehyde |
| 2-Benzofurancarboxaldehyde,5-nitro |
| 2-formyl-5-nitro-1-benzofuran |