5-{[(Benzyloxy)carbonyl]amino}pentanoic acid structure
|
Common Name | 5-{[(Benzyloxy)carbonyl]amino}pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 23135-50-4 | Molecular Weight | 251.278 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 459.9±38.0 °C at 760 mmHg | |
| Molecular Formula | C13H17NO4 | Melting Point | 106ºC | |
| MSDS | N/A | Flash Point | 231.9±26.8 °C | |
Use of 5-{[(Benzyloxy)carbonyl]amino}pentanoic acid |
| Name | 5-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 459.9±38.0 °C at 760 mmHg |
| Melting Point | 106ºC |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.278 |
| Flash Point | 231.9±26.8 °C |
| Exact Mass | 251.115753 |
| PSA | 75.63000 |
| LogP | 2.05 |
| Appearance of Characters | Solid | Off-white |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | QYYPKLYDFCYGPG-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCNC(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~89%
5-{[(Benzyloxy)... CAS#:23135-50-4 |
| Literature: Schmuck, Carsten; Rehm, Thomas; Geiger, Lars; Schaefer, Mathias Journal of Organic Chemistry, 2007 , vol. 72, # 16 p. 6162 - 6170 |
|
~%
5-{[(Benzyloxy)... CAS#:23135-50-4 |
| Literature: US6153442 A1, ; |
|
~%
5-{[(Benzyloxy)... CAS#:23135-50-4 |
| Literature: EP298135 A1, ; EP 0298135 A1 |
|
~30%
5-{[(Benzyloxy)... CAS#:23135-50-4 |
| Literature: Journal of the Indian Chemical Society, , vol. 75, # 10-12 p. 583 - 589 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Cbz-5-aminovaleric Acid |
| Pentanoic acid, 5-[[(phenylmethoxy)carbonyl]amino]- |
| 5-(Carbobenzoxyamino)pentanoic Acid |
| 5-benzyloxycarbonylaminovaleric acid |
| 5-(CarbobenzoxyaMino)valeric Acid |
| N-Cbz-5-aminopentanoic Acid |
| 5-{[(Benzyloxy)carbonyl]amino}pentanoic acid |
| N-benzyloxycarbonyl-5-amino-pentanoic acid |
| N-benzyloxycarbonyl-5-aminovaleric acid |