1-[(E)-2-nitroethenyl]-4-prop-2-ynoxybenzene
Modify Date: 2025-08-20 12:32:13
![1-[(E)-2-nitroethenyl]-4-prop-2-ynoxybenzene Structure](https://image.chemsrc.com/caspic/484/23123-77-5.png)
1-[(E)-2-nitroethenyl]-4-prop-2-ynoxybenzene structure
|
Common Name | 1-[(E)-2-nitroethenyl]-4-prop-2-ynoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 23123-77-5 | Molecular Weight | 203.19400 | |
| Density | 1.213g/cm3 | Boiling Point | 365.1ºC at 760 mmHg | |
| Molecular Formula | C11H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.8ºC | |
| Name | 1-[(E)-2-nitroethenyl]-4-prop-2-ynoxybenzene |
|---|
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 365.1ºC at 760 mmHg |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.19400 |
| Flash Point | 172.8ºC |
| Exact Mass | 203.05800 |
| PSA | 55.05000 |
| LogP | 2.46920 |
| Vapour Pressure | 3.37E-05mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | VPSGWNSHLGZFII-BQYQJAHWSA-N |
| SMILES | C#CCOc1ccc(C=C[N+](=O)[O-])cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |