Docosanoic acid,8,9,13-trihydroxy-
Modify Date: 2025-08-22 15:53:14
Docosanoic acid,8,9,13-trihydroxy- structure
|
Common Name | Docosanoic acid,8,9,13-trihydroxy- | ||
|---|---|---|---|---|
| CAS Number | 23066-89-9 | Molecular Weight | 388.58200 | |
| Density | 1.022g/cm3 | Boiling Point | 581.3ºC at 760mmHg | |
| Molecular Formula | C22H44O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.4ºC | |
| Name | 8,9,13-trihydroxydocosanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.022g/cm3 |
|---|---|
| Boiling Point | 581.3ºC at 760mmHg |
| Molecular Formula | C22H44O5 |
| Molecular Weight | 388.58200 |
| Flash Point | 319.4ºC |
| Exact Mass | 388.31900 |
| PSA | 97.99000 |
| LogP | 4.80530 |
| Vapour Pressure | 6.24E-16mmHg at 25°C |
| Index of Refraction | 1.49 |
| InChIKey | JHAAEJPYWGVVFN-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(O)CCCC(O)C(O)CCCCCCC(=O)O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Docosanoic acid,8,9,13-trihydroxy |
| 8,9,13-Thda |
| 8,9,13-Trihydroxydocosansaeure |