Benzenamine, N-methyl-2-nitro-4-phenoxy- structure
|
Common Name | Benzenamine, N-methyl-2-nitro-4-phenoxy- | ||
|---|---|---|---|---|
| CAS Number | 23042-47-9 | Molecular Weight | 244.24600 | |
| Density | 1.276 | Boiling Point | 378.6ºC | |
| Molecular Formula | C13H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.8ºC | |
| Name | N-methyl-2-nitro-4-phenoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276 |
|---|---|
| Boiling Point | 378.6ºC |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.24600 |
| Flash Point | 182.8ºC |
| Exact Mass | 244.08500 |
| PSA | 67.08000 |
| LogP | 4.02500 |
| Vapour Pressure | 6.23E-06mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | YBZDGUKDRPGRLP-UHFFFAOYSA-N |
| SMILES | CNc1ccc(Oc2ccccc2)cc1[N+](=O)[O-] |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| n-methyl-2-nitro-4-phenoxy-aniline |
| 4-Phenoxy-2-nitro-N-methylanilin |