Phosphoric triamide,N,N,N',N',N'',N''-hexa-2-propen-1-yl-
Modify Date: 2025-09-27 10:36:14
Phosphoric triamide,N,N,N',N',N'',N''-hexa-2-propen-1-yl- structure
|
Common Name | Phosphoric triamide,N,N,N',N',N'',N''-hexa-2-propen-1-yl- | ||
|---|---|---|---|---|
| CAS Number | 23029-47-2 | Molecular Weight | 335.42400 | |
| Density | 0.98g/cm3 | Boiling Point | 421.5ºC at 760mmHg | |
| Molecular Formula | C18H30N3OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.7ºC | |
| Name | N-bis[bis(prop-2-enyl)amino]phosphoryl-N-prop-2-enylprop-2-en-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.98g/cm3 |
|---|---|
| Boiling Point | 421.5ºC at 760mmHg |
| Molecular Formula | C18H30N3OP |
| Molecular Weight | 335.42400 |
| Flash Point | 208.7ºC |
| Exact Mass | 335.21300 |
| PSA | 36.60000 |
| LogP | 4.11650 |
| Vapour Pressure | 2.6E-07mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | QUPFZBHBJFUGBC-UHFFFAOYSA-N |
| SMILES | C=CCN(CC=C)P(=O)(N(CC=C)CC=C)N(CC=C)CC=C |
|
~%
Phosphoric tria... CAS#:23029-47-2 |
| Literature: Sosnovsky; Lukszo European Journal of Medicinal Chemistry, 1984 , vol. 19, # 4 p. 331 - 340 |
|
~%
Phosphoric tria... CAS#:23029-47-2 |
| Literature: Sosnovsky; Lukszo European Journal of Medicinal Chemistry, 1984 , vol. 19, # 4 p. 331 - 340 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Hexaallylphosphorsaeuretriamid |