Stannane,1H-inden-1-yltrimethyl- structure
|
Common Name | Stannane,1H-inden-1-yltrimethyl- | ||
|---|---|---|---|---|
| CAS Number | 23022-40-4 | Molecular Weight | 278.95600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1H-inden-1-yltrimethyl-Stannane |
|---|
| Molecular Formula | C12H16Sn |
|---|---|
| Molecular Weight | 278.95600 |
| Exact Mass | 280.02700 |
| LogP | 3.27390 |
| Vapour Pressure | 0.00309mmHg at 25°C |
| InChIKey | GWWFMBNBRVZBPC-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)C1C=Cc2ccccc21 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |