Hydrazinecarbothioamide,2-[1-methyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2-propen-1-ylidene]- structure
|
Common Name | Hydrazinecarbothioamide,2-[1-methyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2-propen-1-ylidene]- | ||
|---|---|---|---|---|
| CAS Number | 2302-90-1 | Molecular Weight | 265.41800 | |
| Density | 1.07g/cm3 | Boiling Point | 385.2ºC at 760mmHg | |
| Molecular Formula | C14H23N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.8ºC | |
| Name | [(E)-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]amino]thiourea |
|---|
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 385.2ºC at 760mmHg |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.41800 |
| Flash Point | 186.8ºC |
| Exact Mass | 265.16100 |
| PSA | 82.50000 |
| LogP | 4.36950 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | HIWGVXBHBZVTTC-UQQCGOLSSA-N |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=NNC(N)=S |
|
~%
Hydrazinecarbot... CAS#:2302-90-1 |
| Literature: Naves Helvetica Chimica Acta, 1949 , vol. 32, p. 1064,1068 Full Text Show Details Gillam; West Journal of the Chemical Society, 1942 , p. 483,486 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |