Azido-PEG35-amine
Modify Date: 2025-08-27 09:48:01
Azido-PEG35-amine structure
|
Common Name | Azido-PEG35-amine | ||
|---|---|---|---|---|
| CAS Number | 2301851-71-6 | Molecular Weight | 1627.95 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C72H146N4O35 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG35-amineAzido-PEG35-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG35-amine |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG35-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C72H146N4O35 |
|---|---|
| Molecular Weight | 1627.95 |
| InChIKey | RFQQBVVZWHNZSR-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN |
| Azido-PEG35 amine |