Acetamide,N-[2,3,5,6-tetrafluoro-4-(2-phenyldiazenyl)phenyl]- structure
|
Common Name | Acetamide,N-[2,3,5,6-tetrafluoro-4-(2-phenyldiazenyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 22955-58-4 | Molecular Weight | 311.23400 | |
| Density | 1.39g/cm3 | Boiling Point | 436.8ºC at 760mmHg | |
| Molecular Formula | C14H9F4N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218ºC | |
| Name | (E)-N-(2,3,5,6-tetrafluoro-4-(phenyldiazenyl)phenyl)acetamide |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 436.8ºC at 760mmHg |
| Molecular Formula | C14H9F4N3O |
| Molecular Weight | 311.23400 |
| Flash Point | 218ºC |
| Exact Mass | 311.06800 |
| PSA | 53.82000 |
| LogP | 4.68980 |
| Vapour Pressure | 7.87E-08mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | LMXFUBGALRVPGT-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c(F)c(F)c(N=Nc2ccccc2)c(F)c1F |
|
~%
Acetamide,N-[2,... CAS#:22955-58-4 |
| Literature: Namkung,M.J. et al. Journal of Organic Chemistry, 1970 , vol. 35, # 3 p. 728 - 733 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |