dimetofrine structure
|
Common Name | dimetofrine | ||
|---|---|---|---|---|
| CAS Number | 22950-29-4 | Molecular Weight | 227.25700 | |
| Density | 1.182g/cm3 | Boiling Point | 412.3ºC at 760mmHg | |
| Molecular Formula | C11H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.2ºC | |
| Name | dimetofrine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 412.3ºC at 760mmHg |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.25700 |
| Flash Point | 203.2ºC |
| Exact Mass | 227.11600 |
| PSA | 70.95000 |
| LogP | 1.05310 |
| Vapour Pressure | 1.54E-07mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | ZKGDBJAHIIXDDW-UHFFFAOYSA-N |
| SMILES | CNCC(O)c1cc(OC)c(O)c(OC)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Dimetrophine |
| Pressamina |
| Dimethophrin |
| Anassicol |
| dimethophrine |