[(E)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] ethyl carbonate
Modify Date: 2025-09-18 18:28:24
![[(E)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] ethyl carbonate Structure](https://image.chemsrc.com/caspic/026/22936-34-1.png)
[(E)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] ethyl carbonate structure
|
Common Name | [(E)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] ethyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 22936-34-1 | Molecular Weight | 375.37700 | |
| Density | 1.22g/cm3 | Boiling Point | 419.2ºC at 760mmHg | |
| Molecular Formula | C15H22NO6PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.3ºC | |
| Name | [(E)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] ethyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 419.2ºC at 760mmHg |
| Molecular Formula | C15H22NO6PS |
| Molecular Weight | 375.37700 |
| Flash Point | 207.3ºC |
| Exact Mass | 375.09100 |
| PSA | 117.48000 |
| LogP | 4.91060 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | QEBMRZMCJGHZRW-FOWTUZBSSA-N |
| SMILES | CCOC(=O)ON=C(C)c1ccc(OP(=S)(OCC)OCC)cc1 |
| Phosphorothioic acid,O-(4-(1-(((ethoxycarbonyl)oxy)imino)ethyl)phenyl) O,O-diethyl ester |
| Phosphorothioic acid,O,O-diethyl ester,O-ester with 4'-hydroxyacetophenone O-(ethoxycarbonyl)oxime |
| O-(4-(1-(((Ethoxycarbonyl)oxy)imino)ethyl)phenyl) O,O-diethyl phosphorothioate |