3-Nitrophenylalanine structure
|
Common Name | 3-Nitrophenylalanine | ||
|---|---|---|---|---|
| CAS Number | 22888-56-8 | Molecular Weight | 210.187 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 410.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.3±25.9 °C | |
| Name | 3-nitro-dl-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 410.8±35.0 °C at 760 mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.187 |
| Flash Point | 202.3±25.9 °C |
| Exact Mass | 210.064056 |
| PSA | 109.14000 |
| LogP | 0.84 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | YTHDRUZHNYKZGF-UHFFFAOYSA-N |
| SMILES | NC(Cc1cccc([N+](=O)[O-])c1)C(=O)O |
| HS Code | 2922499990 |
|---|
|
~%
3-Nitrophenylalanine CAS#:22888-56-8 |
| Literature: Journal of the American Chemical Society, , vol. 81, p. 3103,3107 |
|
~%
3-Nitrophenylalanine CAS#:22888-56-8 |
| Literature: Journal of the American Chemical Society, , vol. 81, p. 3103,3107 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-ethynylnitrobenzene |
| 3-Nitrophenylalanine |
| m-nitrophenylalanine |
| 3-Nitro-phenylalanin |
| 1-Aethinyl-3-nitro-benzol |
| 1-ethynyl-3-nitro-benzene |
| 3-Nitrophenylethyne |
| 3-nitro-phenylalanine |
| 3-Nitrophenylacetylene |
| m-nitrophenylacetylene |
| m-Nitro-phenylalanin |
| Phenylalanine, 3-nitro- |
| DL-m-Nitrophenylalanin |
| Benzene,1-ethynyl-3-nitro |