Benzene, 1,4-dibromo-2,5-bis(1,1-dimethylethyl)-
Modify Date: 2025-10-29 20:08:45
Benzene, 1,4-dibromo-2,5-bis(1,1-dimethylethyl)- structure
|
Common Name | Benzene, 1,4-dibromo-2,5-bis(1,1-dimethylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 22875-47-4 | Molecular Weight | 348.11700 | |
| Density | 1.364g/cm3 | Boiling Point | 304.9ºC at 760 mmHg | |
| Molecular Formula | C14H20Br2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.8ºC | |
| Name | 1,4-dibromo-2,5-ditert-butylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.364g/cm3 |
|---|---|
| Boiling Point | 304.9ºC at 760 mmHg |
| Molecular Formula | C14H20Br2 |
| Molecular Weight | 348.11700 |
| Flash Point | 158.8ºC |
| Exact Mass | 345.99300 |
| LogP | 5.80660 |
| Vapour Pressure | 0.00153mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | QRONMIVHPIBNGK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Br)c(C(C)(C)C)cc1Br |
| HS Code | 2903999090 |
|---|
|
~%
Benzene, 1,4-di... CAS#:22875-47-4 |
| Literature: Theilacker,W.; Koch,F. Chemische Berichte, 1969 , vol. 102, p. 2020 - 2025 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,4-Dibrom-2,5-di-tert-butyl-benzol |
| 2,5-dibromo-1,4-di-tert-butylbenzene |
| 1,4-dibromo-2,5-di-tert-butyl-benzene |