Naphtho[2,3-b]furan-2(3H)-one,decahydro-6,7-dihydroxy-8a-methyl-3,5-bis(methylene)-, (3aR,4aR,6R,7R,8aR,9aR)- structure
|
Common Name | Naphtho[2,3-b]furan-2(3H)-one,decahydro-6,7-dihydroxy-8a-methyl-3,5-bis(methylene)-, (3aR,4aR,6R,7R,8aR,9aR)- | ||
|---|---|---|---|---|
| CAS Number | 22850-59-5 | Molecular Weight | 264.31700 | |
| Density | 1.24g/cm3 | Boiling Point | 445.5ºC at 760mmHg | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167ºC | |
| Name | 6,7-dihydroxy-8a-methyl-3,5-dimethylidene-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 445.5ºC at 760mmHg |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.31700 |
| Flash Point | 167ºC |
| Exact Mass | 264.13600 |
| PSA | 66.76000 |
| LogP | 1.18220 |
| Vapour Pressure | 8.3E-10mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | IHJJQRWGZDGKAE-UHFFFAOYSA-N |
| SMILES | C=C1C(=O)OC2CC3(C)CC(O)C(O)C(=C)C3CC12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| pulchellin C |
| SESQUITERPENE LACTONE TS-8 |
| Pulchilliin C |