MRS2179 ammonium salt structure
|
Common Name | MRS2179 ammonium salt | ||
|---|---|---|---|---|
| CAS Number | 228264-19-5 | Molecular Weight | 425.228302 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17N5O9P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MRS2179 ammonium saltMRS2179 ammonium salt is a competitive purinergic P2Y1 receptor antagonist (Kb, 102 nM). MRS2179 ammonium salt is selective for P2Y1 over P2Y2, P2Y4, P2Y6, P2Y12, and P2Y13, as well as P2X1-4, receptors. |
| Name | MRS2179 (ammonium salt) |
|---|
| Molecular Formula | C11H17N5O9P2 |
|---|---|
| Molecular Weight | 425.228302 |
| InChIKey | XLRFQRWTKMBUNH-HNPMAXIBSA-N |
| SMILES | CNc1ncnc2c1ncn2C1CC(OP(=O)(O)O)C(COP(=O)(O)O)O1.N |