rt-am
Modify Date: 2025-11-28 16:56:44
rt-am structure
|
Common Name | rt-am | ||
|---|---|---|---|---|
| CAS Number | 2280796-94-1 | Molecular Weight | 555.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C??H??N?O?? | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of rt-amRT-AM is a pro-drug real thiol. Real Thiol is a reversible reaction-based fluorescent probe which can quantitatively monitor the real-time glutathione dynamics in living cells. |
| Name | rt-am |
|---|
| Molecular Formula | C??H??N?O?? |
|---|---|
| Molecular Weight | 555.49 |
| InChIKey | CLCCMBNDDZVBCA-AWQFTUOYSA-N |
| SMILES | CC(=O)OCOC(=O)CN(CC(=O)OCOC(C)=O)C(=O)C(C#N)=Cc1cc2ccc(N3CCC3)cc2oc1=O |