2-Butenedioicacid, 2-chloro-, dipropyl ester, (Z)- (9CI)
Modify Date: 2025-12-17 12:42:48
2-Butenedioicacid, 2-chloro-, dipropyl ester, (Z)- (9CI) structure
|
Common Name | 2-Butenedioicacid, 2-chloro-, dipropyl ester, (Z)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 22801-46-3 | Molecular Weight | 234.67700 | |
| Density | 1.142g/cm3 | Boiling Point | 291.4ºC at 760mmHg | |
| Molecular Formula | C10H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.6ºC | |
| Name | dipropyl (Z)-2-chlorobut-2-enedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 291.4ºC at 760mmHg |
| Molecular Formula | C10H15ClO4 |
| Molecular Weight | 234.67700 |
| Flash Point | 110.6ºC |
| Exact Mass | 234.06600 |
| PSA | 52.60000 |
| LogP | 2.01550 |
| Vapour Pressure | 0.00195mmHg at 25°C |
| Index of Refraction | 1.464 |
| InChIKey | VTUCYQFUIWDWJL-FPLPWBNLSA-N |
| SMILES | CCCOC(=O)C=C(Cl)C(=O)OCCC |
|
~%
2-Butenedioicac... CAS#:22801-46-3 |
| Literature: Gershon; Shanks Journal of Pharmaceutical Sciences, 1978 , vol. 67, # 4 p. 578 - 580 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| n-Propyl-chlorfumarat |
| Dipropyl-chlorfumarat |