Orotic acid butyl ester
Modify Date: 2025-09-25 18:11:00
Orotic acid butyl ester structure
|
Common Name | Orotic acid butyl ester | ||
|---|---|---|---|---|
| CAS Number | 22754-37-6 | Molecular Weight | 212.20300 | |
| Density | 1.248g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butyl 2,4-dioxo-1H-pyrimidine-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20300 |
| Exact Mass | 212.08000 |
| PSA | 92.02000 |
| LogP | 0.02010 |
| Index of Refraction | 1.498 |
| InChIKey | AKSYFXKHZGSZNB-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
|
~%
Orotic acid but... CAS#:22754-37-6 |
| Literature: Falk; Lucke Pharmazie, 1989 , vol. 44, # 9 p. 647 - 647 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-dioxo-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid butyl ester |
| Butylorotat |
| butyl orotate |
| Butyl ester of orotic acid |
| 4-pyrimidinecarboxylic acid,2,6-dihydroxy-,butyl ester |
| n-Butyl orotate |
| 6-n-Butoxycarbonyl-uracil |
| butyl 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate |
| Orotsaeurebutylester |