N-(2-benzoyl-4-chlorophenyl)-2-bromo-N-(2,2,2-trifluoroethyl)acetamide
Modify Date: 2025-09-20 18:47:32
N-(2-benzoyl-4-chlorophenyl)-2-bromo-N-(2,2,2-trifluoroethyl)acetamide structure
|
Common Name | N-(2-benzoyl-4-chlorophenyl)-2-bromo-N-(2,2,2-trifluoroethyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 22753-81-7 | Molecular Weight | 434.63500 | |
| Density | 1.567g/cm3 | Boiling Point | 512.3ºC at 760 mmHg | |
| Molecular Formula | C17H12BrClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.6ºC | |
| Name | N-(2-benzoyl-4-chlorophenyl)-2-bromo-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.567g/cm3 |
|---|---|
| Boiling Point | 512.3ºC at 760 mmHg |
| Molecular Formula | C17H12BrClF3NO2 |
| Molecular Weight | 434.63500 |
| Flash Point | 263.6ºC |
| Exact Mass | 432.96900 |
| PSA | 37.38000 |
| LogP | 4.86120 |
| Vapour Pressure | 1.31E-10mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | YOHLFPANLAUXOX-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1cc(Cl)ccc1N(CC(F)(F)F)C(=O)CBr |
| HS Code | 2924299090 |
|---|
|
~%
N-(2-benzoyl-4-... CAS#:22753-81-7 |
| Literature: Steinman,M. et al. Journal of Medicinal Chemistry, 1973 , vol. 16, p. 1354 - 1360 |
![5-chloro-2-[(2,2,2-trifluoroethyl)amino]benzophenone structure](https://image.chemsrc.com/caspic/177/22753-80-6.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 245-200-0 |