(2E)-3-(4-Azidophenyl)acrylaldehyde structure
|
Common Name | (2E)-3-(4-Azidophenyl)acrylaldehyde | ||
|---|---|---|---|---|
| CAS Number | 22736-78-3 | Molecular Weight | 173.171 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7N3O | Melting Point | 75ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of (2E)-3-(4-Azidophenyl)acrylaldehyde |
| Name | 3-(4-azidophenyl)prop-2-enal |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 75ºC |
|---|---|
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.171 |
| Exact Mass | 173.058914 |
| PSA | 66.82000 |
| LogP | 2.49 |
| InChIKey | MFGPIUGUWLAIGM-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1ccc(C=CC=O)cc1 |
| RIDADR | 1325 |
|---|---|
| Packaging Group | III |
| HS Code | 2929909090 |
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Azidocinnamaldehyde |
| 3-(4-Azidophenyl)-2-propenal |
| 3-(4-Azidophenyl)acrylaldehyde |
| 2-Propenal, 3-(4-azidophenyl)-, (2E)- |
| (2E)-3-(4-Azidophenyl)acrylaldehyde |
| A0971 |